C30H35N3O5S — CID 163074785
4-hexoxy-N-[4-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide (PubChem CID 163074785) has the molecular formula C30H35N3O5S and a molecular weight of 549.69 g/mol. Its IUPAC name is 4-hexoxy-N-[4-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide.
| Compound Name | 4-hexoxy-N-[4-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 163074785 |
| Molecular Formula | C30H35N3O5S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 4-hexoxy-N-[4-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3C[C@H]4C[C@H](C3)c3cccc(=O)n3C4)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O5S/c1-2-3-4-5-17-38-26-13-9-23(10-14-26)30(35)31-25-11-15-27(16-12-25)39(36,37)32-19-22-18-24(21-32)28-7-6-8-29(34)33(28)20-22/h6-16,22,24H,2-5,17-21H2,1H3,(H,31,35)/t22-,24-/m1/s1 |
| InChIKey | JCIDDKPFFUWEPV-ISKFKSNPSA-N |
| XLogP | 4.87 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|