C29H33N3O5S — CID 6568016
N-[4-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]-4-pentoxybenzamide (PubChem CID 6568016) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is N-[4-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]-4-pentoxybenzamide.
| Compound Name | N-[4-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 6568016 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N-[4-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)cc2)cc1 |
| InChI | InChI=1S/C29H33N3O5S/c1-2-3-4-16-37-25-12-8-22(9-13-25)29(34)30-24-10-14-26(15-11-24)38(35,36)31-18-21-17-23(20-31)27-6-5-7-28(33)32(27)19-21/h5-15,21,23H,2-4,16-20H2,1H3,(H,30,34)/t21-,23+/m1/s1 |
| InChIKey | VMDPJYMROPBMFI-GGAORHGYSA-N |
| XLogP | 4.48 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|