C24H21ClN4O6S — CID 6567999
4-chloro-3-nitro-N-[4-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide (PubChem CID 6567999) has the molecular formula C24H21ClN4O6S and a molecular weight of 528.97 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-[4-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide.
| Compound Name | 4-chloro-3-nitro-N-[4-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6567999 |
| Molecular Formula | C24H21ClN4O6S |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 4-chloro-3-nitro-N-[4-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2C[C@@H]3C[C@H](C2)c2cccc(=O)n2C3)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21ClN4O6S/c25-20-9-4-16(11-22(20)29(32)33)24(31)26-18-5-7-19(8-6-18)36(34,35)27-12-15-10-17(14-27)21-2-1-3-23(30)28(21)13-15/h1-9,11,15,17H,10,12-14H2,(H,26,31)/t15-,17+/m0/s1 |
| InChIKey | WRXUBMCDPVMCFP-DOTOQJQBSA-N |
| XLogP | 3.47 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|