C18H19NO4 — CID 163074797
ethyl (1R,5R,6R,7S)-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 163074797) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl (1R,5R,6R,7S)-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | ethyl (1R,5R,6R,7S)-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 163074797 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl (1R,5R,6R,7S)-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C=C[C@@]3(CN(c4cccc(C)c4)C(=O)[C@H]13)O2 |
| InChI | InChI=1S/C18H19NO4/c1-3-22-17(21)14-13-7-8-18(23-13)10-19(16(20)15(14)18)12-6-4-5-11(2)9-12/h4-9,13-15H,3,10H2,1-2H3/t13-,14-,15-,18-/m0/s1 |
| InChIKey | WGPUMASERPUING-XSWJXKHESA-N |
| XLogP | 1.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|