C17H16BrNO4 — CID 163099843
ethyl (1R,5R,6S,7S)-3-(4-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 163099843) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is ethyl (1R,5R,6S,7S)-3-(4-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | ethyl (1R,5R,6S,7S)-3-(4-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 163099843 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | ethyl (1R,5R,6S,7S)-3-(4-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C=C[C@@]3(CN(c4ccc(Br)cc4)C(=O)[C@H]13)O2 |
| InChI | InChI=1S/C17H16BrNO4/c1-2-22-16(21)13-12-7-8-17(23-12)9-19(15(20)14(13)17)11-5-3-10(18)4-6-11/h3-8,12-14H,2,9H2,1H3/t12-,13+,14-,17-/m0/s1 |
| InChIKey | UZCDCFJLCWGSQV-LOUJCGABSA-N |
| XLogP | 2.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|