C31H42O6 — CID 163076419
[(1S,2S,4aR,4bR,8aR,10aR)-4'-acetyloxy-2,4b,7',8,8,10a-hexamethyl-7-oxospiro[3,4,4a,5,6,8a,9,10-octahydro-2H-phenanthrene-1,2'-3H-1-benzofuran]-5'-yl] acetate (PubChem CID 163076419) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is [(1S,2S,4aR,4bR,8aR,10aR)-4'-acetyloxy-2,4b,7',8,8,10a-hexamethyl-7-oxospiro[3,4,4a,5,6,8a,9,10-octahydro-2H-phenanthrene-1,2'-3H-1-benzofuran]-5'-yl] acetate.
| Compound Name | [(1S,2S,4aR,4bR,8aR,10aR)-4'-acetyloxy-2,4b,7',8,8,10a-hexamethyl-7-oxospiro[3,4,4a,5,6,8a,9,10-octahydro-2H-phenanthrene-1,2'-3H-1-benzofuran]-5'-yl] acetate |
|---|---|
| PubChem CID | 163076419 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [(1S,2S,4aR,4bR,8aR,10aR)-4'-acetyloxy-2,4b,7',8,8,10a-hexamethyl-7-oxospiro[3,4,4a,5,6,8a,9,10-octahydro-2H-phenanthrene-1,2'-3H-1-benzofuran]-5'-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1OC(C)=O)C[C@]1(O2)[C@@H](C)CC[C@@H]2[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C31H42O6/c1-17-15-22(35-19(3)32)27(36-20(4)33)21-16-31(37-26(17)21)18(2)9-10-24-29(7)13-12-25(34)28(5,6)23(29)11-14-30(24,31)8/h15,18,23-24H,9-14,16H2,1-8H3/t18-,23-,24+,29-,30+,31-/m0/s1 |
| InChIKey | ORDLKHPYSBKJCH-NXKDKKSYSA-N |
| XLogP | 6.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|