C11H17NO2 — CID 163076668
(4S,7S,7aS)-4-hydroxy-2,4,7-trimethyl-1,3,7,7a-tetrahydrocyclopenta[c]pyridin-6-one (PubChem CID 163076668) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (4S,7S,7aS)-4-hydroxy-2,4,7-trimethyl-1,3,7,7a-tetrahydrocyclopenta[c]pyridin-6-one.
| Compound Name | (4S,7S,7aS)-4-hydroxy-2,4,7-trimethyl-1,3,7,7a-tetrahydrocyclopenta[c]pyridin-6-one |
|---|---|
| PubChem CID | 163076668 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (4S,7S,7aS)-4-hydroxy-2,4,7-trimethyl-1,3,7,7a-tetrahydrocyclopenta[c]pyridin-6-one |
| SMILES | C[C@@H]1C(=O)C=C2[C@H]1CN(C)C[C@@]2(C)O |
| InChI | InChI=1S/C11H17NO2/c1-7-8-5-12(3)6-11(2,14)9(8)4-10(7)13/h4,7-8,14H,5-6H2,1-3H3/t7-,8-,11+/m0/s1 |
| InChIKey | HSCGGKMCCLYDMN-DKCNOQQISA-N |
| XLogP | 0.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |