C16H23N3O3 — CID 177208472
2,2-dihydroxy-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one;ethane (PubChem CID 177208472) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2,2-dihydroxy-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one;ethane.
| Compound Name | 2,2-dihydroxy-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one;ethane |
|---|---|
| PubChem CID | 177208472 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2,2-dihydroxy-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one;ethane |
| SMILES | CC.CN1CCC2C(C1)c1cccc3c1N2C(O)(O)C(=O)N3 |
| InChI | InChI=1S/C14H17N3O3.C2H6/c1-16-6-5-11-9(7-16)8-3-2-4-10-12(8)17(11)14(19,20)13(18)15-10;1-2/h2-4,9,11,19-20H,5-7H2,1H3,(H,15,18);1-2H3 |
| InChIKey | IWPRFNNPROXMPY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|