C16H22FN3O — CID 177208495
ethane;8-fluoro-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-3-one (PubChem CID 177208495) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is ethane;8-fluoro-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-3-one.
| Compound Name | ethane;8-fluoro-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-3-one |
|---|---|
| PubChem CID | 177208495 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | ethane;8-fluoro-12-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-3-one |
| SMILES | CC.CN1CCC2C(C1)c1c(F)ccc3c1N2CC(=O)N3 |
| InChI | InChI=1S/C14H16FN3O.C2H6/c1-17-5-4-11-8(6-17)13-9(15)2-3-10-14(13)18(11)7-12(19)16-10;1-2/h2-3,8,11H,4-7H2,1H3,(H,16,19);1-2H3 |
| InChIKey | QCNLHDFDQVWPHF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |