C14H16BN3O — CID 169230568
CID 169230568 (PubChem CID 169230568) has the molecular formula C14H16BN3O and a molecular weight of 253.11 g/mol.
| Compound Name | CID 169230568 |
|---|---|
| PubChem CID | 169230568 |
| Molecular Formula | C14H16BN3O |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | — |
| SMILES | [B]N1CC[C@@H]2C(C1)c1cccc3c1N2CC(=O)N3C |
| InChI | InChI=1S/C14H16BN3O/c1-16-12-4-2-3-9-10-7-17(15)6-5-11(10)18(14(9)12)8-13(16)19/h2-4,10-11H,5-8H2,1H3/t10?,11-/m1/s1 |
| InChIKey | NMLVHGUUHDTZFY-RRKGBCIJSA-N |
| XLogP | 0.72 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|