C22H25ClN4O — CID 177208227
(10R,15S)-12-[3-(3-chloro-2-pyridinyl)propyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 177208227) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is (10R,15S)-12-[3-(3-chloro-2-pyridinyl)propyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-12-[3-(3-chloro-2-pyridinyl)propyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 177208227 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (10R,15S)-12-[3-(3-chloro-2-pyridinyl)propyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CN1C(=O)CN2c3c(cccc31)[C@@H]1CN(CCCc3ncccc3Cl)CC[C@@H]12 |
| InChI | InChI=1S/C22H25ClN4O/c1-25-20-8-2-5-15-16-13-26(11-4-7-18-17(23)6-3-10-24-18)12-9-19(16)27(22(15)20)14-21(25)28/h2-3,5-6,8,10,16,19H,4,7,9,11-14H2,1H3/t16-,19-/m0/s1 |
| InChIKey | JEVUITDAXDJPEA-LPHOPBHVSA-N |
| XLogP | 3.32 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |