C23H25ClN4O — CID 162661645
1-[(2R)-4-(3-chloro-4-pyridinyl)-2-methylpiperazin-1-yl]-4-quinolin-5-ylbutan-1-one (PubChem CID 162661645) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-[(2R)-4-(3-chloro-4-pyridinyl)-2-methylpiperazin-1-yl]-4-quinolin-5-ylbutan-1-one.
| Compound Name | 1-[(2R)-4-(3-chloro-4-pyridinyl)-2-methylpiperazin-1-yl]-4-quinolin-5-ylbutan-1-one |
|---|---|
| PubChem CID | 162661645 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[(2R)-4-(3-chloro-4-pyridinyl)-2-methylpiperazin-1-yl]-4-quinolin-5-ylbutan-1-one |
| SMILES | C[C@@H]1CN(c2ccncc2Cl)CCN1C(=O)CCCc1cccc2ncccc12 |
| InChI | InChI=1S/C23H25ClN4O/c1-17-16-27(22-10-12-25-15-20(22)24)13-14-28(17)23(29)9-3-6-18-5-2-8-21-19(18)7-4-11-26-21/h2,4-5,7-8,10-12,15,17H,3,6,9,13-14,16H2,1H3/t17-/m1/s1 |
| InChIKey | LSFWYDSWGFYERW-QGZVFWFLSA-N |
| XLogP | 4.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |