C16H21N3OS — CID 177208176
4-methyl-12-(1-sulfanylethyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 177208176) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-methyl-12-(1-sulfanylethyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | 4-methyl-12-(1-sulfanylethyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 177208176 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-methyl-12-(1-sulfanylethyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CC(S)N1CCC2C(C1)c1cccc3c1N2CC(=O)N3C |
| InChI | InChI=1S/C16H21N3OS/c1-10(21)18-7-6-13-12(8-18)11-4-3-5-14-16(11)19(13)9-15(20)17(14)2/h3-5,10,12-13,21H,6-9H2,1-2H3 |
| InChIKey | RQVZBVGWWBBLSN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|