C18H23N3O3 — CID 177128130
ethyl 6-methyl-7-oxo-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate (PubChem CID 177128130) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 6-methyl-7-oxo-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate.
| Compound Name | ethyl 6-methyl-7-oxo-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
|---|---|
| PubChem CID | 177128130 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethyl 6-methyl-7-oxo-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
| SMILES | CCOC(=O)N1CCC2C(C1)c1cccc3c1N2CCC(=O)N3C |
| InChI | InChI=1S/C18H23N3O3/c1-3-24-18(23)20-9-7-14-13(11-20)12-5-4-6-15-17(12)21(14)10-8-16(22)19(15)2/h4-6,13-14H,3,7-11H2,1-2H3 |
| InChIKey | QDEMARFKVXCESI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |