C24H33N3O2 — CID 177177729
ethyl 4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 177177729) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is ethyl 4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | ethyl 4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 177177729 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | ethyl 4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.CCOC(=O)N1CCC2C(C1)c1cccc3c1N2CCN3C |
| InChI | InChI=1S/C17H23N3O2.C7H10/c1-3-22-17(21)19-8-7-14-13(11-19)12-5-4-6-15-16(12)20(14)10-9-18(15)2;1-4-6-7(3)5-2/h4-6,13-14H,3,7-11H2,1-2H3;4-6H,1-2H2,3H3/b;7-6- |
| InChIKey | NYAAYUKSLYJLLH-VDXOJYAPSA-N |
| XLogP | 4.58 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|