C25H29N3O4 — CID 154942705
ethyl (2S,10S,15S)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate (PubChem CID 154942705) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl (2S,10S,15S)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate.
| Compound Name | ethyl (2S,10S,15S)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
|---|---|
| PubChem CID | 154942705 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl (2S,10S,15S)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H]2[C@H](C1)c1cccc3c1N2[C@@H](C)C(=O)N3Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-4-32-25(30)26-13-12-21-20(15-26)19-6-5-7-22-23(19)28(21)16(2)24(29)27(22)14-17-8-10-18(31-3)11-9-17/h5-11,16,20-21H,4,12-15H2,1-3H3/t16-,20+,21-/m0/s1 |
| InChIKey | FTMJYUDQTXEPSL-DQLDELGASA-N |
| XLogP | 3.76 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |