C26H31N3O2 — CID 177208467
(10R,15S)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 177208467) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (10R,15S)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 177208467 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (10R,15S)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CCN1C(=O)CN2c3c(cccc31)[C@@H]1CN(CCCc3cccc4c3OCC4)CC[C@@H]12 |
| InChI | InChI=1S/C26H31N3O2/c1-2-28-23-10-4-9-20-21-16-27(14-11-22(21)29(25(20)23)17-24(28)30)13-5-8-18-6-3-7-19-12-15-31-26(18)19/h3-4,6-7,9-10,21-22H,2,5,8,11-17H2,1H3/t21-,22-/m0/s1 |
| InChIKey | UYVPTGSNLDHWAH-VXKWHMMOSA-N |
| XLogP | 3.60 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |