C25H29N3O2 — CID 177208723
(10R,15S)-12-[4-(2,3-dihydro-1-benzofuran-7-yl)butan-2-yl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 177208723) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (10R,15S)-12-[4-(2,3-dihydro-1-benzofuran-7-yl)butan-2-yl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-12-[4-(2,3-dihydro-1-benzofuran-7-yl)butan-2-yl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 177208723 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (10R,15S)-12-[4-(2,3-dihydro-1-benzofuran-7-yl)butan-2-yl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CC(CCc1cccc2c1OCC2)N1CC[C@H]2[C@@H](C1)c1cccc3c1N2CC(=O)N3 |
| InChI | InChI=1S/C25H29N3O2/c1-16(8-9-17-4-2-5-18-11-13-30-25(17)18)27-12-10-22-20(14-27)19-6-3-7-21-24(19)28(22)15-23(29)26-21/h2-7,16,20,22H,8-15H2,1H3,(H,26,29)/t16?,20-,22-/m0/s1 |
| InChIKey | WPFJCMCLKVIFPR-OIGSQQCRSA-N |
| XLogP | 3.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |