C25H30N2O — CID 177208315
(10S,15R)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene (PubChem CID 177208315) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is (10S,15R)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene.
| Compound Name | (10S,15R)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 177208315 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (10S,15R)-12-[3-(2,3-dihydro-1-benzofuran-7-yl)propyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
| SMILES | c1cc(CCCN2CC[C@@H]3[C@H](C2)c2cccc4c2N3CCC4)c2c(c1)CCO2 |
| InChI | InChI=1S/C25H30N2O/c1-6-19(25-20(7-1)12-16-28-25)9-3-13-26-15-11-23-22(17-26)21-10-2-5-18-8-4-14-27(23)24(18)21/h1-2,5-7,10,22-23H,3-4,8-9,11-17H2/t22-,23-/m1/s1 |
| InChIKey | GOCQZLIISDGEMK-DHIUTWEWSA-N |
| XLogP | 4.18 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |