C24H30N2OS — CID 172549480
(11R,16S)-14-[3-(2-methoxyphenyl)propyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 172549480) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is (11R,16S)-14-[3-(2-methoxyphenyl)propyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-14-[3-(2-methoxyphenyl)propyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 172549480 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (11R,16S)-14-[3-(2-methoxyphenyl)propyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | COc1ccccc1CCCN1CC[C@@H]2[C@H](C1)c1cccc3c1N2CCCS3 |
| InChI | InChI=1S/C24H30N2OS/c1-27-22-10-3-2-7-18(22)8-5-13-25-15-12-21-20(17-25)19-9-4-11-23-24(19)26(21)14-6-16-28-23/h2-4,7,9-11,20-21H,5-6,8,12-17H2,1H3/t20-,21-/m1/s1 |
| InChIKey | BBXZLZVJPGNNQE-NHCUHLMSSA-N |
| XLogP | 4.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |