C25H32N2O — CID 158940296
(1R)-4-[(10R,15S)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]-1-(4-methylphenyl)butan-1-ol (PubChem CID 158940296) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is (1R)-4-[(10R,15S)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]-1-(4-methylphenyl)butan-1-ol.
| Compound Name | (1R)-4-[(10R,15S)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]-1-(4-methylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 158940296 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (1R)-4-[(10R,15S)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-12-yl]-1-(4-methylphenyl)butan-1-ol |
| SMILES | Cc1ccc([C@H](O)CCCN2CC[C@H]3[C@@H](C2)c2cccc4c2N3CCC4)cc1 |
| InChI | InChI=1S/C25H32N2O/c1-18-9-11-19(12-10-18)24(28)8-4-14-26-16-13-23-22(17-26)21-7-2-5-20-6-3-15-27(23)25(20)21/h2,5,7,9-12,22-24,28H,3-4,6,8,13-17H2,1H3/t22-,23-,24+/m0/s1 |
| InChIKey | JKDUUMGOJLDWCH-KMDXXIMOSA-N |
| XLogP | 4.43 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |