C23H27FN2Y-2 — CID 58195933
fluorobenzene;(10R,15S)-12-propyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene;yttrium (PubChem CID 58195933) has the molecular formula C23H27FN2Y-2 and a molecular weight of 439.39 g/mol. Its IUPAC name is fluorobenzene;(10R,15S)-12-propyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene;yttrium.
| Compound Name | fluorobenzene;(10R,15S)-12-propyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene;yttrium |
|---|---|
| PubChem CID | 58195933 |
| Molecular Formula | C23H27FN2Y-2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | fluorobenzene;(10R,15S)-12-propyl-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene;yttrium |
| SMILES | Fc1cc[c-]cc1.[CH2-]CCN1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCC3.[Y] |
| InChI | InChI=1S/C17H23N2.C6H4F.Y/c1-2-9-18-11-8-16-15(12-18)14-7-3-5-13-6-4-10-19(16)17(13)14;7-6-4-2-1-3-5-6;/h3,5,7,15-16H,1-2,4,6,8-12H2;2-5H;/q2*-1;/t15-,16-;;/m0../s1 |
| InChIKey | LLFIZVYVBLXSCP-SXBSVMRRSA-N |
| XLogP | 4.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|