C17H24FN3O3 — CID 163076976
3-fluoro-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzamide (PubChem CID 163076976) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-fluoro-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzamide.
| Compound Name | 3-fluoro-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 163076976 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-fluoro-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzamide |
| SMILES | CN1CCN(CC2OCC(NC(=O)c3cccc(F)c3)C2O)CC1 |
| InChI | InChI=1S/C17H24FN3O3/c1-20-5-7-21(8-6-20)10-15-16(22)14(11-24-15)19-17(23)12-3-2-4-13(18)9-12/h2-4,9,14-16,22H,5-8,10-11H2,1H3,(H,19,23) |
| InChIKey | QTALSXIAGPISOW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |