C22H34O3 — CID 163077435
[(1R,2E,4Z,8E,12R)-8,12-dimethyl-1-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-4-yl]methyl acetate (PubChem CID 163077435) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1R,2E,4Z,8E,12R)-8,12-dimethyl-1-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-4-yl]methyl acetate.
| Compound Name | [(1R,2E,4Z,8E,12R)-8,12-dimethyl-1-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-4-yl]methyl acetate |
|---|---|
| PubChem CID | 163077435 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1R,2E,4Z,8E,12R)-8,12-dimethyl-1-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C\CC/C(C)=C/CC[C@]2(C)CC[C@@](C(C)C)(\C=C/1)O2 |
| InChI | InChI=1S/C22H34O3/c1-17(2)22-13-11-20(16-24-19(4)23)10-6-8-18(3)9-7-12-21(5,25-22)14-15-22/h9-11,13,17H,6-8,12,14-16H2,1-5H3/b13-11-,18-9+,20-10-/t21-,22-/m1/s1 |
| InChIKey | VJOLPTVYFWUITI-RBTUSLFOSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|