C16H28O8 — CID 163077463
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)oxan-2-yl] (2R)-2-methylbutanoate (PubChem CID 163077463) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)oxan-2-yl] (2R)-2-methylbutanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)oxan-2-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163077463 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)oxan-2-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC(=O)CC(C)C |
| InChI | InChI=1S/C16H28O8/c1-5-9(4)15(21)24-16-14(23-11(18)6-8(2)3)13(20)12(19)10(7-17)22-16/h8-10,12-14,16-17,19-20H,5-7H2,1-4H3/t9-,10-,12-,13+,14-,16+/m1/s1 |
| InChIKey | QFSROZDKMJOOSY-CTXXCBDISA-N |
| XLogP | -0.03 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |