C19H30O3 — CID 163078550
(3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-6-oxo-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 163078550) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-6-oxo-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-6-oxo-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163078550 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-6-oxo-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC1=C2CC[C@@H](C)[C@](C)(CC[C@@H](C)CC(=O)O)[C@H]2CCC1=O |
| InChI | InChI=1S/C19H30O3/c1-12(11-18(21)22)9-10-19(4)13(2)5-6-15-14(3)17(20)8-7-16(15)19/h12-13,16H,5-11H2,1-4H3,(H,21,22)/t12-,13-,16+,19+/m1/s1 |
| InChIKey | QDQZGMMYQOVBSE-LYMQGIMYSA-N |
| XLogP | 4.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |