C26H26O8 — CID 163079466
6-(furan-3-yl)-5,12,16,16-tetramethyl-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-ene-8,13,14,21-tetrone (PubChem CID 163079466) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is 6-(furan-3-yl)-5,12,16,16-tetramethyl-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-ene-8,13,14,21-tetrone.
| Compound Name | 6-(furan-3-yl)-5,12,16,16-tetramethyl-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-ene-8,13,14,21-tetrone |
|---|---|
| PubChem CID | 163079466 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 6-(furan-3-yl)-5,12,16,16-tetramethyl-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-ene-8,13,14,21-tetrone |
| SMILES | CC1(C)OCC23C=CC(=O)C12C(=O)C(=O)C1(C)C3CCC2(C)C(c3ccoc3)OC(=O)C3OC321 |
| InChI | InChI=1S/C26H26O8/c1-21(2)25-15(27)6-9-24(25,12-32-21)14-5-8-22(3)18(13-7-10-31-11-13)33-20(30)19-26(22,34-19)23(14,4)16(28)17(25)29/h6-7,9-11,14,18-19H,5,8,12H2,1-4H3 |
| InChIKey | DNGIYWIRBISPJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 112.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|