C31H36O9 — CID 162900150
[(1R,2R,5S,6S,9S,11R,12S,13R,15R)-6-(furan-3-yl)-5,12,16,16-tetramethyl-8,14,21-trioxo-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-en-13-yl] 3-methylbutanoate (PubChem CID 162900150) has the molecular formula C31H36O9 and a molecular weight of 552.62 g/mol. Its IUPAC name is [(1R,2R,5S,6S,9S,11R,12S,13R,15R)-6-(furan-3-yl)-5,12,16,16-tetramethyl-8,14,21-trioxo-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-en-13-yl] 3-methylbutanoate.
| Compound Name | [(1R,2R,5S,6S,9S,11R,12S,13R,15R)-6-(furan-3-yl)-5,12,16,16-tetramethyl-8,14,21-trioxo-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-en-13-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162900150 |
| Molecular Formula | C31H36O9 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [(1R,2R,5S,6S,9S,11R,12S,13R,15R)-6-(furan-3-yl)-5,12,16,16-tetramethyl-8,14,21-trioxo-7,10,17-trioxahexacyclo[13.3.3.01,15.02,12.05,11.09,11]henicos-19-en-13-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H]1C(=O)[C@]23C(=O)C=C[C@@]2(COC3(C)C)[C@H]2CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@]12C |
| InChI | InChI=1S/C31H36O9/c1-16(2)13-20(33)38-23-21(34)30-19(32)8-11-29(30,15-37-26(30,3)4)18-7-10-27(5)22(17-9-12-36-14-17)39-25(35)24-31(27,40-24)28(18,23)6/h8-9,11-12,14,16,18,22-24H,7,10,13,15H2,1-6H3/t18-,22-,23-,24+,27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | XCCVRHOIHNXBNH-PMRLGCQHSA-N |
| XLogP | 3.90 |
| TPSA | 121.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|