C46H68N2O7 — CID 163080398
[6,8,20-trihydroxy-3,11-dimethyl-6-(3-methyl-6-phenylhexyl)-20-[2-(5-oxo-2H-furan-3-yl)ethyl]-14-pentyl-17,18-diazapentacyclo[9.7.1.13,7.07,19.012,16]icos-4-en-1-yl] acetate (PubChem CID 163080398) has the molecular formula C46H68N2O7 and a molecular weight of 761.06 g/mol. Its IUPAC name is [6,8,20-trihydroxy-3,11-dimethyl-6-(3-methyl-6-phenylhexyl)-20-[2-(5-oxo-2H-furan-3-yl)ethyl]-14-pentyl-17,18-diazapentacyclo[9.7.1.13,7.07,19.012,16]icos-4-en-1-yl] acetate.
| Compound Name | [6,8,20-trihydroxy-3,11-dimethyl-6-(3-methyl-6-phenylhexyl)-20-[2-(5-oxo-2H-furan-3-yl)ethyl]-14-pentyl-17,18-diazapentacyclo[9.7.1.13,7.07,19.012,16]icos-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 163080398 |
| Molecular Formula | C46H68N2O7 |
| Molecular Weight | 761.06 g/mol |
| Exact Mass | 760.50 |
| IUPAC Name | [6,8,20-trihydroxy-3,11-dimethyl-6-(3-methyl-6-phenylhexyl)-20-[2-(5-oxo-2H-furan-3-yl)ethyl]-14-pentyl-17,18-diazapentacyclo[9.7.1.13,7.07,19.012,16]icos-4-en-1-yl] acetate |
| SMILES | CCCCCC1CC2NNC3(OC(C)=O)CC4(C)C=CC(O)(CCC(C)CCCc5ccccc5)C5(C(O)CCC(C)(C2C1)C35)C4(O)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C46H68N2O7/c1-6-7-9-16-34-26-36-37(27-34)47-48-44(55-32(3)49)30-41(4)24-25-43(52,22-18-31(2)13-12-17-33-14-10-8-11-15-33)46(38(50)20-21-42(36,5)40(44)46)45(41,53)23-19-35-28-39(51)54-29-35/h8,10-11,14-15,24-25,28,31,34,36-38,40,47-48,50,52-53H,6-7,9,12-13,16-23,26-27,29-30H2,1-5H3 |
| InChIKey | IAMCTADXXSXJHP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.06 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|