C24H23N3O5 — CID 163080403
[4-[(1R,3R,3aR,6aR)-2',4,6-trioxo-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate (PubChem CID 163080403) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is [4-[(1R,3R,3aR,6aR)-2',4,6-trioxo-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate.
| Compound Name | [4-[(1R,3R,3aR,6aR)-2',4,6-trioxo-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 163080403 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [4-[(1R,3R,3aR,6aR)-2',4,6-trioxo-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@H]3[C@@H](C(C)C)N[C@]4(C(=O)Nc5ccccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H23N3O5/c1-12(2)20-18-19(24(26-20)16-6-4-5-7-17(16)25-23(24)31)22(30)27(21(18)29)14-8-10-15(11-9-14)32-13(3)28/h4-12,18-20,26H,1-3H3,(H,25,31)/t18-,19+,20-,24+/m1/s1 |
| InChIKey | IQCOJZDMHYTKKF-ZSTWQFLISA-N |
| XLogP | 2.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|