C28H23N3O7 — CID 4837499
[4-[1-[(3,4-dihydroxyphenyl)methyl]-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate (PubChem CID 4837499) has the molecular formula C28H23N3O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is [4-[1-[(3,4-dihydroxyphenyl)methyl]-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate.
| Compound Name | [4-[1-[(3,4-dihydroxyphenyl)methyl]-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 4837499 |
| Molecular Formula | C28H23N3O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [4-[1-[(3,4-dihydroxyphenyl)methyl]-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C(Cc4ccc(O)c(O)c4)NC4(C(=O)Nc5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C28H23N3O7/c1-14(32)38-17-9-7-16(8-10-17)31-25(35)23-20(12-15-6-11-21(33)22(34)13-15)30-28(24(23)26(31)36)18-4-2-3-5-19(18)29-27(28)37/h2-11,13,20,23-24,30,33-34H,12H2,1H3,(H,29,37) |
| InChIKey | ISQZJESVIRGBDJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|