C29H24ClN3O7 — CID 98222430
[4-[(1S,3S,3aR,6aS)-7'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate (PubChem CID 98222430) has the molecular formula C29H24ClN3O7 and a molecular weight of 561.98 g/mol. Its IUPAC name is [4-[(1S,3S,3aR,6aS)-7'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate.
| Compound Name | [4-[(1S,3S,3aR,6aS)-7'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 98222430 |
| Molecular Formula | C29H24ClN3O7 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | [4-[(1S,3S,3aR,6aS)-7'-chloro-1-[(3,4-dihydroxyphenyl)methyl]-5'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@@H]3[C@H](Cc4ccc(O)c(O)c4)N[C@@]4(C(=O)Nc5c(Cl)cc(C)cc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H24ClN3O7/c1-13-9-18-25(19(30)10-13)31-28(39)29(18)24-23(20(32-29)11-15-3-8-21(35)22(36)12-15)26(37)33(27(24)38)16-4-6-17(7-5-16)40-14(2)34/h3-10,12,20,23-24,32,35-36H,11H2,1-2H3,(H,31,39)/t20-,23+,24-,29+/m0/s1 |
| InChIKey | QCWJBNRDIMBYET-ZUWWUPDZSA-N |
| XLogP | 3.15 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|