C30H27N3O7 — CID 162886875
[4-[(1S,3R,3aS,6aS)-1-[(3,4-dihydroxyphenyl)methyl]-5'-ethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate (PubChem CID 162886875) has the molecular formula C30H27N3O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is [4-[(1S,3R,3aS,6aS)-1-[(3,4-dihydroxyphenyl)methyl]-5'-ethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate.
| Compound Name | [4-[(1S,3R,3aS,6aS)-1-[(3,4-dihydroxyphenyl)methyl]-5'-ethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 162886875 |
| Molecular Formula | C30H27N3O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | [4-[(1S,3R,3aS,6aS)-1-[(3,4-dihydroxyphenyl)methyl]-5'-ethyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-5-yl]phenyl] acetate |
| SMILES | CCc1ccc2c(c1)[C@@]1(N[C@@H](Cc3ccc(O)c(O)c3)[C@H]3C(=O)N(c4ccc(OC(C)=O)cc4)C(=O)[C@@H]31)C(=O)N2 |
| InChI | InChI=1S/C30H27N3O7/c1-3-16-4-10-21-20(12-16)30(29(39)31-21)26-25(22(32-30)13-17-5-11-23(35)24(36)14-17)27(37)33(28(26)38)18-6-8-19(9-7-18)40-15(2)34/h4-12,14,22,25-26,32,35-36H,3,13H2,1-2H3,(H,31,39)/t22-,25+,26+,30-/m0/s1 |
| InChIKey | DEYSWADUDUVMAW-GYMZGOSFSA-N |
| XLogP | 2.75 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|