C23H28O8 — CID 163082768
(9-formyl-5'-hydroxy-3',3',5',9-tetramethyl-14-oxospiro[5,13-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-10,2'-oxolane]-11-yl) acetate (PubChem CID 163082768) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is (9-formyl-5'-hydroxy-3',3',5',9-tetramethyl-14-oxospiro[5,13-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-10,2'-oxolane]-11-yl) acetate.
| Compound Name | (9-formyl-5'-hydroxy-3',3',5',9-tetramethyl-14-oxospiro[5,13-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-10,2'-oxolane]-11-yl) acetate |
|---|---|
| PubChem CID | 163082768 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (9-formyl-5'-hydroxy-3',3',5',9-tetramethyl-14-oxospiro[5,13-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-10,2'-oxolane]-11-yl) acetate |
| SMILES | CC(=O)OC1C2OC(=O)C3c4ccoc4CC(C32)C(C)(C=O)C12OC(C)(O)CC2(C)C |
| InChI | InChI=1S/C23H28O8/c1-11(25)29-18-17-16-13(8-14-12(6-7-28-14)15(16)19(26)30-17)21(4,10-24)23(18)20(2,3)9-22(5,27)31-23/h6-7,10,13,15-18,27H,8-9H2,1-5H3 |
| InChIKey | UGNZPDFYESFDHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|