C20H28O4 — CID 163083822
[(1R,3S,4E,7S,10R)-4,10-dimethyl-9-oxo-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] (Z)-2-methylbut-2-enoate (PubChem CID 163083822) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1R,3S,4E,7S,10R)-4,10-dimethyl-9-oxo-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,3S,4E,7S,10R)-4,10-dimethyl-9-oxo-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163083822 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1R,3S,4E,7S,10R)-4,10-dimethyl-9-oxo-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)[C@H]1C/C=C(\C)[C@@H](OC(=O)/C(C)=C\C)C[C@H]2O[C@@]2(C)C(=O)C1 |
| InChI | InChI=1S/C20H28O4/c1-7-13(4)19(22)23-16-11-18-20(6,24-18)17(21)10-15(12(2)3)9-8-14(16)5/h7-8,15-16,18H,2,9-11H2,1,3-6H3/b13-7-,14-8+/t15-,16-,18+,20-/m0/s1 |
| InChIKey | YLDOPNCDYCPJSW-DHSYOYLYSA-N |
| XLogP | 3.91 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|