C15H22O7 — CID 163083942
(2S,3R,4S,5S,6R)-2-[3-(2-hydroxyethyl)-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163083942) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-(2-hydroxyethyl)-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-(2-hydroxyethyl)-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163083942 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-(2-hydroxyethyl)-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(CCO)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C15H22O7/c1-8-4-9(2-3-16)6-10(5-8)21-15-14(20)13(19)12(18)11(7-17)22-15/h4-6,11-20H,2-3,7H2,1H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | MMGAVCFAFFQDCQ-UXXRCYHCSA-N |
| XLogP | -1.29 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |