C25H34O7 — CID 163086207
[(1S,2S,4aS,9S,10aS)-1,9-diacetyloxy-6-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate (PubChem CID 163086207) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [(1S,2S,4aS,9S,10aS)-1,9-diacetyloxy-6-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate.
| Compound Name | [(1S,2S,4aS,9S,10aS)-1,9-diacetyloxy-6-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 163086207 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(1S,2S,4aS,9S,10aS)-1,9-diacetyloxy-6-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2[C@](C)(OC(C)=O)[C@@H](OC(C)=O)CC[C@]2(C)c2cc(O)c(C(C)C)cc21 |
| InChI | InChI=1S/C25H34O7/c1-13(2)17-10-18-19(11-20(17)29)24(6)9-8-23(31-15(4)27)25(7,32-16(5)28)22(24)12-21(18)30-14(3)26/h10-11,13,21-23,29H,8-9,12H2,1-7H3/t21-,22-,23-,24+,25-/m0/s1 |
| InChIKey | RYHLIIWRCPVHRD-BDUWWWMKSA-N |
| XLogP | 4.44 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|