C28H40O4 — CID 163089304
[(1R)-1-methyl-2-oxocyclohex-3-en-1-yl] (2Z)-2-[(1R,3aR,7aR)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-5-oxo-1,2,3,3a,6,7-hexahydroinden-4-ylidene]acetate (PubChem CID 163089304) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is [(1R)-1-methyl-2-oxocyclohex-3-en-1-yl] (2Z)-2-[(1R,3aR,7aR)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-5-oxo-1,2,3,3a,6,7-hexahydroinden-4-ylidene]acetate.
| Compound Name | [(1R)-1-methyl-2-oxocyclohex-3-en-1-yl] (2Z)-2-[(1R,3aR,7aR)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-5-oxo-1,2,3,3a,6,7-hexahydroinden-4-ylidene]acetate |
|---|---|
| PubChem CID | 163089304 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | [(1R)-1-methyl-2-oxocyclohex-3-en-1-yl] (2Z)-2-[(1R,3aR,7aR)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-5-oxo-1,2,3,3a,6,7-hexahydroinden-4-ylidene]acetate |
| SMILES | CC(C)[C@@H](C)/C=C/[C@H](C)[C@H]1CC[C@H]2/C(=C/C(=O)O[C@]3(C)CCC=CC3=O)C(=O)CC[C@]12C |
| InChI | InChI=1S/C28H40O4/c1-18(2)19(3)10-11-20(4)22-12-13-23-21(24(29)14-16-27(22,23)5)17-26(31)32-28(6)15-8-7-9-25(28)30/h7,9-11,17-20,22-23H,8,12-16H2,1-6H3/b11-10+,21-17-/t19-,20-,22+,23-,27+,28+/m0/s1 |
| InChIKey | HHOHGMGBNVADCJ-RXALKEQMSA-N |
| XLogP | 6.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|