C32H50O7 — CID 163092638
(7,21,22-trihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-14-yl) acetate (PubChem CID 163092638) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is (7,21,22-trihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-14-yl) acetate.
| Compound Name | (7,21,22-trihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-14-yl) acetate |
|---|---|
| PubChem CID | 163092638 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (7,21,22-trihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-14-yl) acetate |
| SMILES | CC(=O)OC1CC23CC24CCC(O)C(C)(C)C4CCC3C2(C)CC3OC4(O)C(OC(C)(C)C4O)C(C)C3C12C |
| InChI | InChI=1S/C32H50O7/c1-16-23-18(38-32(36)24(16)39-27(5,6)25(32)35)13-28(7)20-10-9-19-26(3,4)21(34)11-12-30(19)15-31(20,30)14-22(29(23,28)8)37-17(2)33/h16,18-25,34-36H,9-15H2,1-8H3 |
| InChIKey | ZZIPUOMOQNDCHG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |