C35H56O9 — CID 73088411
2-[(21,22-dihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-7-yl)oxy]oxane-3,4,5-triol (PubChem CID 73088411) has the molecular formula C35H56O9 and a molecular weight of 620.82 g/mol. Its IUPAC name is 2-[(21,22-dihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-7-yl)oxy]oxane-3,4,5-triol.
| Compound Name | 2-[(21,22-dihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-7-yl)oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73088411 |
| Molecular Formula | C35H56O9 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 2-[(21,22-dihydroxy-1,6,6,15,17,20,20-heptamethyl-19,23-dioxaheptacyclo[13.10.0.02,12.05,10.010,12.016,24.018,22]pentacosan-7-yl)oxy]oxane-3,4,5-triol |
| SMILES | CC1C2OC(C)(C)C(O)C2(O)OC2CC3(C)C4CCC5C(C)(C)C(OC6OCC(O)C(O)C6O)CCC56CC46CCC3(C)C21 |
| InChI | InChI=1S/C35H56O9/c1-17-23-19(43-35(40)26(17)44-30(4,5)28(35)39)14-32(7)21-9-8-20-29(2,3)22(42-27-25(38)24(37)18(36)15-41-27)10-11-33(20)16-34(21,33)13-12-31(23,32)6/h17-28,36-40H,8-16H2,1-7H3 |
| InChIKey | RQTXEZTYXQREQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|