C19H22O4 — CID 163092798
[(2E,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-en-8-yl] 3-methylbutanoate (PubChem CID 163092798) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(2E,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-en-8-yl] 3-methylbutanoate.
| Compound Name | [(2E,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-en-8-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163092798 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [(2E,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-en-8-yl] 3-methylbutanoate |
| SMILES | CC#CC#C/C=C1\C=C[C@]2(CC[C@@H](OC(=O)CC(C)C)CO2)O1 |
| InChI | InChI=1S/C19H22O4/c1-4-5-6-7-8-16-9-11-19(23-16)12-10-17(14-21-19)22-18(20)13-15(2)3/h8-9,11,15,17H,10,12-14H2,1-3H3/b16-8+/t17-,19-/m1/s1 |
| InChIKey | OREUTJZDPOZILC-YBFUFRCZSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|