C18H18O5 — CID 163186323
[(1S,2S,3'S,4Z,5R)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-yl] 3-methylbutanoate (PubChem CID 163186323) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is [(1S,2S,3'S,4Z,5R)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-yl] 3-methylbutanoate.
| Compound Name | [(1S,2S,3'S,4Z,5R)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163186323 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [(1S,2S,3'S,4Z,5R)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-3H-furan]-3'-yl] 3-methylbutanoate |
| SMILES | CC#CC#C/C=C1\O[C@]2(OC=C[C@@H]2OC(=O)CC(C)C)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C18H18O5/c1-4-5-6-7-8-13-16-17(22-16)18(23-13)14(9-10-20-18)21-15(19)11-12(2)3/h8-10,12,14,16-17H,11H2,1-3H3/b13-8-/t14-,16-,17-,18-/m0/s1 |
| InChIKey | AVBDYCCRUUGQMY-CDYMQWSXSA-N |
| XLogP | 1.89 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|