C30H46O6 — CID 163093078
[7-hydroxy-17-[3-hydroxy-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 163093078) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is [7-hydroxy-17-[3-hydroxy-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [7-hydroxy-17-[3-hydroxy-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 163093078 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | [7-hydroxy-17-[3-hydroxy-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)C=C2CC(O)C3C4CCC(C(C)C(O)CC5(C)OC5(C)C)C4(C)CCC3C21C |
| InChI | InChI=1S/C30H46O6/c1-16(24(34)15-29(6)27(3,4)36-29)20-8-9-21-26-22(10-11-28(20,21)5)30(7)18(13-23(26)33)12-19(32)14-25(30)35-17(2)31/h12,16,20-26,33-34H,8-11,13-15H2,1-7H3 |
| InChIKey | PKWPQVWQFPYZMA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|