C40H48N2O6 — CID 163018131
[10,13-dimethyl-3-oxo-17-[3-(pyridine-3-carbonyloxy)-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] pyridine-3-carboxylate (PubChem CID 163018131) has the molecular formula C40H48N2O6 and a molecular weight of 652.83 g/mol. Its IUPAC name is [10,13-dimethyl-3-oxo-17-[3-(pyridine-3-carbonyloxy)-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] pyridine-3-carboxylate.
| Compound Name | [10,13-dimethyl-3-oxo-17-[3-(pyridine-3-carbonyloxy)-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163018131 |
| Molecular Formula | C40H48N2O6 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | [10,13-dimethyl-3-oxo-17-[3-(pyridine-3-carbonyloxy)-4-(2,3,3-trimethyloxiran-2-yl)butan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] pyridine-3-carboxylate |
| SMILES | CC(C(CC1(C)OC1(C)C)OC(=O)c1cccnc1)C1CCC2C3C(OC(=O)c4cccnc4)CC4=CC(=O)C=CC4(C)C3CCC12C |
| InChI | InChI=1S/C40H48N2O6/c1-24(33(21-40(6)37(2,3)48-40)47-36(45)26-10-8-18-42-23-26)29-11-12-30-34-31(14-16-39(29,30)5)38(4)15-13-28(43)19-27(38)20-32(34)46-35(44)25-9-7-17-41-22-25/h7-10,13,15,17-19,22-24,29-34H,11-12,14,16,20-21H2,1-6H3 |
| InChIKey | OBLJWSXLUWIEPP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|