C35H53NO2 — CID 22303556
[(8S,9S,10R,13R,14S,17R)-17-[(2R)-4-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pyridine-3-carboxylate (PubChem CID 22303556) has the molecular formula C35H53NO2 and a molecular weight of 519.81 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-17-[(2R)-4-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pyridine-3-carboxylate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R)-4-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22303556 |
| Molecular Formula | C35H53NO2 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.41 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R)-4-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pyridine-3-carboxylate |
| SMILES | CCC(CC(C)C)C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OC(=O)c5cccnc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H53NO2/c1-7-25(19-23(2)3)20-24(4)30-12-13-31-29-11-10-27-21-28(38-33(37)26-9-8-18-36-22-26)14-16-34(27,5)32(29)15-17-35(30,31)6/h8-10,18,22-25,28-32H,7,11-17,19-21H2,1-6H3/t24-,25?,28?,29+,30-,31+,32+,34+,35-/m1/s1 |
| InChIKey | QXFNNZWRLWVWOK-LRTMRCBCSA-N |
| XLogP | 9.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|