C34H58O3 — CID 67745289
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethylbutyl carbonate (PubChem CID 67745289) has the molecular formula C34H58O3 and a molecular weight of 514.84 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethylbutyl carbonate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethylbutyl carbonate |
|---|---|
| PubChem CID | 67745289 |
| Molecular Formula | C34H58O3 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.44 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethylbutyl carbonate |
| SMILES | CCC(CC)COC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C34H58O3/c1-8-25(9-2)22-36-32(35)37-27-17-19-33(6)26(21-27)13-14-28-30-16-15-29(24(5)12-10-11-23(3)4)34(30,7)20-18-31(28)33/h13,23-25,27-31H,8-12,14-22H2,1-7H3/t24-,27+,28+,29-,30+,31+,33+,34-/m1/s1 |
| InChIKey | OLLCEJXJEOLTSB-LLHZKFLPSA-N |
| XLogP | 9.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|