C26H40O8 — CID 163094469
5,5,9-trimethyl-14-methylidene-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxytetracyclo[11.2.1.01,10.04,9]hexadecan-15-one (PubChem CID 163094469) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is 5,5,9-trimethyl-14-methylidene-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxytetracyclo[11.2.1.01,10.04,9]hexadecan-15-one.
| Compound Name | 5,5,9-trimethyl-14-methylidene-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxytetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
|---|---|
| PubChem CID | 163094469 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 5,5,9-trimethyl-14-methylidene-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxytetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
| SMILES | C=C1C(=O)C23CCC4C(C)(C)CC(OOC5OC(CO)C(O)C(O)C5O)CC4(C)C2CCC1C3 |
| InChI | InChI=1S/C26H40O8/c1-13-14-5-6-18-25(4)11-15(33-34-23-21(30)20(29)19(28)16(12-27)32-23)10-24(2,3)17(25)7-8-26(18,9-14)22(13)31/h14-21,23,27-30H,1,5-12H2,2-4H3 |
| InChIKey | HXDLNVIFXURGGQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|