C19H32O3 — CID 163096046
(1'S,2'R,6'R,8'S,9'S,10'R)-9'-(hydroxymethyl)-10'-(methoxymethyl)-1',2'-dimethylspiro[cyclopentane-1,3'-tricyclo[4.4.0.02,8]decane]-10'-ol (PubChem CID 163096046) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (1'S,2'R,6'R,8'S,9'S,10'R)-9'-(hydroxymethyl)-10'-(methoxymethyl)-1',2'-dimethylspiro[cyclopentane-1,3'-tricyclo[4.4.0.02,8]decane]-10'-ol.
| Compound Name | (1'S,2'R,6'R,8'S,9'S,10'R)-9'-(hydroxymethyl)-10'-(methoxymethyl)-1',2'-dimethylspiro[cyclopentane-1,3'-tricyclo[4.4.0.02,8]decane]-10'-ol |
|---|---|
| PubChem CID | 163096046 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (1'S,2'R,6'R,8'S,9'S,10'R)-9'-(hydroxymethyl)-10'-(methoxymethyl)-1',2'-dimethylspiro[cyclopentane-1,3'-tricyclo[4.4.0.02,8]decane]-10'-ol |
| SMILES | COC[C@@]1(O)[C@H](CO)[C@@H]2C[C@H]3CCC4(CCCC4)[C@]2(C)[C@]31C |
| InChI | InChI=1S/C19H32O3/c1-16-13-6-9-18(7-4-5-8-18)17(16,2)14(10-13)15(11-20)19(16,21)12-22-3/h13-15,20-21H,4-12H2,1-3H3/t13-,14+,15-,16+,17+,19-/m1/s1 |
| InChIKey | FLAISZZHUJJTFV-MPTZMVSHSA-N |
| XLogP | 2.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |