C29H28O13 — CID 163099201
[(2R,3S,4R,5R,6S)-2-[[(3S,4R)-4-ethenyl-8-oxo-4,6-dihydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate (PubChem CID 163099201) has the molecular formula C29H28O13 and a molecular weight of 584.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2-[[(3S,4R)-4-ethenyl-8-oxo-4,6-dihydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-2-[[(3S,4R)-4-ethenyl-8-oxo-4,6-dihydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 163099201 |
| Molecular Formula | C29H28O13 |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2-[[(3S,4R)-4-ethenyl-8-oxo-4,6-dihydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate |
| SMILES | C=C[C@@H]1C2=CCOC(=O)C2=CO[C@H]1O[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1OC(=O)c1c(O)cc(O)cc1-c1cccc(O)c1 |
| InChI | InChI=1S/C29H28O13/c1-2-16-17-6-7-38-26(36)19(17)12-39-28(16)42-29-25(24(35)23(34)21(11-30)40-29)41-27(37)22-18(9-15(32)10-20(22)33)13-4-3-5-14(31)8-13/h2-6,8-10,12,16,21,23-25,28-35H,1,7,11H2/t16-,21+,23+,24-,25+,28+,29-/m1/s1 |
| InChIKey | URCMCCJTOUPVTF-KABNBQLTSA-N |
| XLogP | 0.98 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|