C24H28O9 — CID 122232245
(3S,4R)-3-[(2S,3R,4S,5S,6R)-6-[(3,4-dimethylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-ethenyl-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one (PubChem CID 122232245) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is (3S,4R)-3-[(2S,3R,4S,5S,6R)-6-[(3,4-dimethylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-ethenyl-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one.
| Compound Name | (3S,4R)-3-[(2S,3R,4S,5S,6R)-6-[(3,4-dimethylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-ethenyl-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one |
|---|---|
| PubChem CID | 122232245 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (3S,4R)-3-[(2S,3R,4S,5S,6R)-6-[(3,4-dimethylphenoxy)methyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-ethenyl-4,6-dihydro-3H-pyrano[3,4-c]pyran-8-one |
| SMILES | C=C[C@@H]1C2=CCOC(=O)C2=CO[C@H]1O[C@@H]1O[C@H](COc2ccc(C)c(C)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H28O9/c1-4-15-16-7-8-29-22(28)17(16)10-31-23(15)33-24-21(27)20(26)19(25)18(32-24)11-30-14-6-5-12(2)13(3)9-14/h4-7,9-10,15,18-21,23-27H,1,8,11H2,2-3H3/t15-,18-,19-,20+,21-,23+,24+/m1/s1 |
| InChIKey | QERBOKUAPBPZSX-JFMGLJEISA-N |
| XLogP | 1.03 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|